About triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide
triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide (PubChem CID 21150177) has the molecular formula C10H25IN2O3
and a molecular weight of 348.23 g/mol. Its IUPAC name is triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide.
Molecular Properties
| Compound Name | triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide |
| PubChem CID | 21150177 |
| Molecular Formula | C10H25IN2O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide |
| SMILES | CC[N+](CC)(CC)CCCO.I.NC(=O)[O-] |
| InChI | InChI=1S/C9H22NO.CH3NO2.HI/c1-4-10(5-2,6-3)8-7-9-11;2-1(3)4;/h11H,4-9H2,1-3H3;2H2,(H,3,4);1H/q+1;;/p-1 |
| InChIKey | YZFVINOJVKHTHN-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide?
The IUPAC name of triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide (CID 21150177) is triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide.
What is the SMILES notation for triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide?
The canonical SMILES for triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide is CC[N+](CC)(CC)CCCO.I.NC(=O)[O-].
What is the InChIKey of triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide?
The InChIKey is YZFVINOJVKHTHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H22NO.CH3NO2.HI/c1-4-10(5-2,6-3)8-7-9-11;2-1(3)4;/h11H,4-9H2,1-3H3;2H2,(H,3,4);1H/q+1;;/p-1.
What are the key properties of triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide?
triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide has a molecular weight of 348.23 g/mol, XLogP of 0.15, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(3-hydroxypropyl)azanium;carbamate;hydroiodide is sourced from PubChem (CID 21150177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).