About 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide
3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide (PubChem CID 3026710) has the molecular formula C20H44IN2O3-
and a molecular weight of 487.49 g/mol. Its IUPAC name is 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide.
Molecular Properties
| Compound Name | 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide |
| PubChem CID | 3026710 |
| Molecular Formula | C20H44IN2O3- |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide |
| SMILES | CCCCC[N+](CCCO)(CCCCC)CCCCC.CNC(=O)[O-].[I-] |
| InChI | InChI=1S/C18H40NO.C2H5NO2.HI/c1-4-7-10-14-19(17-13-18-20,15-11-8-5-2)16-12-9-6-3;1-3-2(4)5;/h20H,4-18H2,1-3H3;3H,1H3,(H,4,5);1H/q+1;;/p-2 |
| InChIKey | FHJOTNGRZQELIT-UHFFFAOYSA-L |
| XLogP | 0.31 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide?
The IUPAC name of 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide (CID 3026710) is 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide.
What is the SMILES notation for 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide?
The canonical SMILES for 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide is CCCCC[N+](CCCO)(CCCCC)CCCCC.CNC(=O)[O-].[I-].
What is the InChIKey of 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide?
The InChIKey is FHJOTNGRZQELIT-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H40NO.C2H5NO2.HI/c1-4-7-10-14-19(17-13-18-20,15-11-8-5-2)16-12-9-6-3;1-3-2(4)5;/h20H,4-18H2,1-3H3;3H,1H3,(H,4,5);1H/q+1;;/p-2.
What are the key properties of 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide?
3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide has a molecular weight of 487.49 g/mol, XLogP of 0.31, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl(tripentyl)azanium;N-methylcarbamate;iodide is sourced from PubChem (CID 3026710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).