About prop-2-ynyl N-(3-iodophenyl)carbamate
prop-2-ynyl N-(3-iodophenyl)carbamate (PubChem CID 22016211) has the molecular formula C10H8INO2
and a molecular weight of 301.08 g/mol. Its IUPAC name is prop-2-ynyl N-(3-iodophenyl)carbamate.
Molecular Properties
| Compound Name | prop-2-ynyl N-(3-iodophenyl)carbamate |
| PubChem CID | 22016211 |
| Molecular Formula | C10H8INO2 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | prop-2-ynyl N-(3-iodophenyl)carbamate |
| SMILES | C#CCOC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C10H8INO2/c1-2-6-14-10(13)12-9-5-3-4-8(11)7-9/h1,3-5,7H,6H2,(H,12,13) |
| InChIKey | QAPLAFKFEATEKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl N-(3-iodophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl N-(3-iodophenyl)carbamate?
The IUPAC name of prop-2-ynyl N-(3-iodophenyl)carbamate (CID 22016211) is prop-2-ynyl N-(3-iodophenyl)carbamate.
What is the SMILES notation for prop-2-ynyl N-(3-iodophenyl)carbamate?
The canonical SMILES for prop-2-ynyl N-(3-iodophenyl)carbamate is C#CCOC(=O)Nc1cccc(I)c1.
What is the InChIKey of prop-2-ynyl N-(3-iodophenyl)carbamate?
The InChIKey is QAPLAFKFEATEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8INO2/c1-2-6-14-10(13)12-9-5-3-4-8(11)7-9/h1,3-5,7H,6H2,(H,12,13).
What are the key properties of prop-2-ynyl N-(3-iodophenyl)carbamate?
prop-2-ynyl N-(3-iodophenyl)carbamate has a molecular weight of 301.08 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl N-(3-iodophenyl)carbamate is sourced from PubChem (CID 22016211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).