C23H24F3N3O — CID 22018999
N-[2-[methyl(propan-2-yl)amino]quinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 22018999) has the molecular formula C23H24F3N3O and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[2-[methyl(propan-2-yl)amino]quinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[2-[methyl(propan-2-yl)amino]quinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 22018999 |
| Molecular Formula | C23H24F3N3O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[2-[methyl(propan-2-yl)amino]quinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)N(C)c1ccc2cc(NC(=O)CCc3ccc(C(F)(F)F)cc3)ccc2n1 |
| InChI | InChI=1S/C23H24F3N3O/c1-15(2)29(3)21-12-7-17-14-19(10-11-20(17)28-21)27-22(30)13-6-16-4-8-18(9-5-16)23(24,25)26/h4-5,7-12,14-15H,6,13H2,1-3H3,(H,27,30) |
| InChIKey | MPLZJJHETRKHRI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |