C21H25FN6OS — CID 22019095
N-[3-(dimethylamino)propyl]-4-fluoro-3-[[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]methylamino]benzamide (PubChem CID 22019095) has the molecular formula C21H25FN6OS and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-fluoro-3-[[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]methylamino]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-fluoro-3-[[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]methylamino]benzamide |
|---|---|
| PubChem CID | 22019095 |
| Molecular Formula | C21H25FN6OS |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-fluoro-3-[[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]methylamino]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(F)c(NCc2cnc(Nc3ccccn3)s2)c1 |
| InChI | InChI=1S/C21H25FN6OS/c1-28(2)11-5-10-24-20(29)15-7-8-17(22)18(12-15)25-13-16-14-26-21(30-16)27-19-6-3-4-9-23-19/h3-4,6-9,12,14,25H,5,10-11,13H2,1-2H3,(H,24,29)(H,23,26,27) |
| InChIKey | LPRFSSJHHUAUKQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|