C19H17BrFN5OS — CID 22019144
3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]methylamino]-N-cyclopropyl-4-fluorobenzamide (PubChem CID 22019144) has the molecular formula C19H17BrFN5OS and a molecular weight of 462.35 g/mol. Its IUPAC name is 3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]methylamino]-N-cyclopropyl-4-fluorobenzamide.
| Compound Name | 3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]methylamino]-N-cyclopropyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 22019144 |
| Molecular Formula | C19H17BrFN5OS |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 3-[[2-[(6-bromo-2-pyridinyl)amino]-1,3-thiazol-5-yl]methylamino]-N-cyclopropyl-4-fluorobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(F)c(NCc2cnc(Nc3cccc(Br)n3)s2)c1 |
| InChI | InChI=1S/C19H17BrFN5OS/c20-16-2-1-3-17(25-16)26-19-23-10-13(28-19)9-22-15-8-11(4-7-14(15)21)18(27)24-12-5-6-12/h1-4,7-8,10,12,22H,5-6,9H2,(H,24,27)(H,23,25,26) |
| InChIKey | FZSXMLQGBINLPP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|