C9H13NO6S — CID 22020969
2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethanol;methanesulfonic acid (PubChem CID 22020969) has the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethanol;methanesulfonic acid.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 22020969 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OCC1COc2cccnc2O1 |
| InChI | InChI=1S/C8H9NO3.CH4O3S/c10-4-6-5-11-7-2-1-3-9-8(7)12-6;1-5(2,3)4/h1-3,6,10H,4-5H2;1H3,(H,2,3,4) |
| InChIKey | QVBXQPYPVUETBK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|