C15H18N4O4 — CID 69255836
1-[3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethylamino)propyl]pyrimidine-2,4-dione (PubChem CID 69255836) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethylamino)propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethylamino)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69255836 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-ylmethylamino)propyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCCNCC2COc3cccnc3O2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H18N4O4/c20-13-4-8-19(15(21)18-13)7-2-5-16-9-11-10-22-12-3-1-6-17-14(12)23-11/h1,3-4,6,8,11,16H,2,5,7,9-10H2,(H,18,20,21) |
| InChIKey | XFSWWSHNCGSEOC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|