C7H4F6O — CID 22022752
2,6-bis(trifluoromethyl)-2H-pyran (PubChem CID 22022752) has the molecular formula C7H4F6O and a molecular weight of 218.10 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)-2H-pyran.
| Compound Name | 2,6-bis(trifluoromethyl)-2H-pyran |
|---|---|
| PubChem CID | 22022752 |
| Molecular Formula | C7H4F6O |
| Molecular Weight | 218.10 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2,6-bis(trifluoromethyl)-2H-pyran |
| SMILES | FC(F)(F)C1=CC=CC(C(F)(F)F)O1 |
| InChI | InChI=1S/C7H4F6O/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-4H |
| InChIKey | AJKILDSUGRMPBB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |