C20H19Cl2N3S — CID 22024345
8-(2,4-dichlorophenyl)-2-methylsulfanyl-N-propyl-N-prop-2-ynylimidazo[1,2-a]pyridin-3-amine (PubChem CID 22024345) has the molecular formula C20H19Cl2N3S and a molecular weight of 404.37 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-2-methylsulfanyl-N-propyl-N-prop-2-ynylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 8-(2,4-dichlorophenyl)-2-methylsulfanyl-N-propyl-N-prop-2-ynylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 22024345 |
| Molecular Formula | C20H19Cl2N3S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-2-methylsulfanyl-N-propyl-N-prop-2-ynylimidazo[1,2-a]pyridin-3-amine |
| SMILES | C#CCN(CCC)c1c(SC)nc2c(-c3ccc(Cl)cc3Cl)cccn12 |
| InChI | InChI=1S/C20H19Cl2N3S/c1-4-10-24(11-5-2)20-19(26-3)23-18-16(7-6-12-25(18)20)15-9-8-14(21)13-17(15)22/h1,6-9,12-13H,5,10-11H2,2-3H3 |
| InChIKey | WOTUZDAURUCNHY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|