C16H21ClN2O3 — CID 22026523
2-[4-amino-2-[(2-methoxyphenyl)methylamino]phenoxy]ethanol;hydrochloride (PubChem CID 22026523) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-[4-amino-2-[(2-methoxyphenyl)methylamino]phenoxy]ethanol;hydrochloride.
| Compound Name | 2-[4-amino-2-[(2-methoxyphenyl)methylamino]phenoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 22026523 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[4-amino-2-[(2-methoxyphenyl)methylamino]phenoxy]ethanol;hydrochloride |
| SMILES | COc1ccccc1CNc1cc(N)ccc1OCCO.Cl |
| InChI | InChI=1S/C16H20N2O3.ClH/c1-20-15-5-3-2-4-12(15)11-18-14-10-13(17)6-7-16(14)21-9-8-19;/h2-7,10,18-19H,8-9,11,17H2,1H3;1H |
| InChIKey | LKTJSCJTIQNNRN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|