C19H28ClN3O4 — CID 22026554
2-[4-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol;hydrochloride (PubChem CID 22026554) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is 2-[4-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol;hydrochloride.
| Compound Name | 2-[4-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 22026554 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[4-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol;hydrochloride |
| SMILES | Cl.Nc1ccc(OCCO)c(NCc2ccc(N(CCO)CCO)cc2)c1 |
| InChI | InChI=1S/C19H27N3O4.ClH/c20-16-3-6-19(26-12-11-25)18(13-16)21-14-15-1-4-17(5-2-15)22(7-9-23)8-10-24;/h1-6,13,21,23-25H,7-12,14,20H2;1H |
| InChIKey | AIHPNKWXTRKVGQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|