C15H19N3O3 — CID 69381115
3-amino-2-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]phenol (PubChem CID 69381115) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-amino-2-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]phenol.
| Compound Name | 3-amino-2-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]phenol |
|---|---|
| PubChem CID | 69381115 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-amino-2-[[5-amino-2-(2-hydroxyethoxy)anilino]methyl]phenol |
| SMILES | Nc1ccc(OCCO)c(NCc2c(N)cccc2O)c1 |
| InChI | InChI=1S/C15H19N3O3/c16-10-4-5-15(21-7-6-19)13(8-10)18-9-11-12(17)2-1-3-14(11)20/h1-5,8,18-20H,6-7,9,16-17H2 |
| InChIKey | LVTCCBALJXDCCW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|