C21H27F3N6O5 — CID 22029694
7-but-2-ynyl-1-methyl-3-(oxolan-2-ylmethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029694) has the molecular formula C21H27F3N6O5 and a molecular weight of 500.48 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-3-(oxolan-2-ylmethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-3-(oxolan-2-ylmethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029694 |
| Molecular Formula | C21H27F3N6O5 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-3-(oxolan-2-ylmethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CC1CCCO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N6O3.C2HF3O2/c1-3-4-9-24-15-16(21-18(24)23-10-7-20-8-11-23)25(13-14-6-5-12-28-14)19(27)22(2)17(15)26;3-2(4,5)1(6)7/h14,20H,5-13H2,1-2H3;(H,6,7) |
| InChIKey | AWHXYWMEJDWPMC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|