C18H12ClFN2O4 — CID 22030956
(E)-3-[4-(4-chloro-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]prop-2-enoic acid (PubChem CID 22030956) has the molecular formula C18H12ClFN2O4 and a molecular weight of 374.76 g/mol. Its IUPAC name is (E)-3-[4-(4-chloro-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-chloro-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22030956 |
| Molecular Formula | C18H12ClFN2O4 |
| Molecular Weight | 374.76 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (E)-3-[4-(4-chloro-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]prop-2-enoic acid |
| SMILES | COc1cc2c(Oc3ccc(Cl)cc3F)ncnc2cc1/C=C/C(=O)O |
| InChI | InChI=1S/C18H12ClFN2O4/c1-25-16-8-12-14(6-10(16)2-5-17(23)24)21-9-22-18(12)26-15-4-3-11(19)7-13(15)20/h2-9H,1H3,(H,23,24)/b5-2+ |
| InChIKey | PKUJTKHPQZSJHI-GORDUTHDSA-N |
| XLogP | 4.32 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|