C40H27FN4O3S2 — CID 22031019
5-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]thiophene-2-sulfonic acid (PubChem CID 22031019) has the molecular formula C40H27FN4O3S2 and a molecular weight of 694.81 g/mol. Its IUPAC name is 5-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]thiophene-2-sulfonic acid.
| Compound Name | 5-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 22031019 |
| Molecular Formula | C40H27FN4O3S2 |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.15 |
| IUPAC Name | 5-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazolin-4-yl]thiophene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(F)cc4)cc23)s1 |
| InChI | InChI=1S/C40H27FN4O3S2/c41-32-19-16-27(17-20-32)38-34(28-18-21-35-33(24-28)39(43-26-42-35)36-22-23-37(49-36)50(46,47)48)25-45(44-38)40(29-10-4-1-5-11-29,30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-26H,(H,46,47,48) |
| InChIKey | FHPFSTAZGOODJQ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|