C43H31FN4O2S2 — CID 22031442
4-(5-cyclopropylsulfonylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazoline (PubChem CID 22031442) has the molecular formula C43H31FN4O2S2 and a molecular weight of 718.88 g/mol. Its IUPAC name is 4-(5-cyclopropylsulfonylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazoline.
| Compound Name | 4-(5-cyclopropylsulfonylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazoline |
|---|---|
| PubChem CID | 22031442 |
| Molecular Formula | C43H31FN4O2S2 |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | 4-(5-cyclopropylsulfonylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]quinazoline |
| SMILES | O=S(=O)(c1ccc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(F)cc4)cc23)s1)C1CC1 |
| InChI | InChI=1S/C43H31FN4O2S2/c44-34-19-16-29(17-20-34)41-37(30-18-23-38-36(26-30)42(46-28-45-38)39-24-25-40(51-39)52(49,50)35-21-22-35)27-48(47-41)43(31-10-4-1-5-11-31,32-12-6-2-7-13-32)33-14-8-3-9-15-33/h1-20,23-28,35H,21-22H2 |
| InChIKey | OQECKBYGHAQXSX-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|