C37H26F3N3O2S2 — CID 22031472
4-(5-methylsulfonylthiophen-2-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline (PubChem CID 22031472) has the molecular formula C37H26F3N3O2S2 and a molecular weight of 665.76 g/mol. Its IUPAC name is 4-(5-methylsulfonylthiophen-2-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline.
| Compound Name | 4-(5-methylsulfonylthiophen-2-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline |
|---|---|
| PubChem CID | 22031472 |
| Molecular Formula | C37H26F3N3O2S2 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | 4-(5-methylsulfonylthiophen-2-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline |
| SMILES | CS(=O)(=O)c1ccc(-c2ccnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4C(F)(F)F)cc23)s1 |
| InChI | InChI=1S/C37H26F3N3O2S2/c1-47(44,45)34-20-19-33(46-34)29-21-22-41-32-18-17-25(23-30(29)32)31-24-43(42-35(31)37(38,39)40)36(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-24H,1H3 |
| InChIKey | RBYUBPAOBDPFKW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|