C22H21BrN2OS — CID 22031317
[1-(6-bromoquinolin-4-yl)piperidin-4-yl]-(4-methylsulfanylphenyl)methanone (PubChem CID 22031317) has the molecular formula C22H21BrN2OS and a molecular weight of 441.39 g/mol. Its IUPAC name is [1-(6-bromoquinolin-4-yl)piperidin-4-yl]-(4-methylsulfanylphenyl)methanone.
| Compound Name | [1-(6-bromoquinolin-4-yl)piperidin-4-yl]-(4-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 22031317 |
| Molecular Formula | C22H21BrN2OS |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | [1-(6-bromoquinolin-4-yl)piperidin-4-yl]-(4-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(C(=O)C2CCN(c3ccnc4ccc(Br)cc34)CC2)cc1 |
| InChI | InChI=1S/C22H21BrN2OS/c1-27-18-5-2-15(3-6-18)22(26)16-9-12-25(13-10-16)21-8-11-24-20-7-4-17(23)14-19(20)21/h2-8,11,14,16H,9-10,12-13H2,1H3 |
| InChIKey | WVVLEKLYFJVDOO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |