C44H34FN7O — CID 22031864
3-[4-(3-azidopropoxy)phenyl]-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine (PubChem CID 22031864) has the molecular formula C44H34FN7O and a molecular weight of 695.80 g/mol. Its IUPAC name is 3-[4-(3-azidopropoxy)phenyl]-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine.
| Compound Name | 3-[4-(3-azidopropoxy)phenyl]-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 22031864 |
| Molecular Formula | C44H34FN7O |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 695.28 |
| IUPAC Name | 3-[4-(3-azidopropoxy)phenyl]-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
| SMILES | [N-]=[N+]=NCCCOc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(F)cc4)cn23)cc1 |
| InChI | InChI=1S/C44H34FN7O/c45-38-22-17-33(18-23-38)43-40(34-21-26-42-47-29-41(51(42)30-34)32-19-24-39(25-20-32)53-28-10-27-48-50-46)31-52(49-43)44(35-11-4-1-5-12-35,36-13-6-2-7-14-36)37-15-8-3-9-16-37/h1-9,11-26,29-31H,10,27-28H2 |
| InChIKey | KHYILPFCSQIMKQ-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|