C7H16N2O3 — CID 22042009
3,6-diamino-5-hydroxyheptanoic acid (PubChem CID 22042009) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3,6-diamino-5-hydroxyheptanoic acid.
| Compound Name | 3,6-diamino-5-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 22042009 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3,6-diamino-5-hydroxyheptanoic acid |
| SMILES | CC(N)C(O)CC(N)CC(=O)O |
| InChI | InChI=1S/C7H16N2O3/c1-4(8)6(10)2-5(9)3-7(11)12/h4-6,10H,2-3,8-9H2,1H3,(H,11,12) |
| InChIKey | NSVYSGGHAIKMOR-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |