C24H25NO2 — CID 22045121
(4-cyanophenyl) 7-ethyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate (PubChem CID 22045121) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4-cyanophenyl) 7-ethyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyanophenyl) 7-ethyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 22045121 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (4-cyanophenyl) 7-ethyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate |
| SMILES | CCC1CCc2c(ccc3c2CCC(C(=O)Oc2ccc(C#N)cc2)C3)C1 |
| InChI | InChI=1S/C24H25NO2/c1-2-16-5-11-22-18(13-16)6-7-19-14-20(8-12-23(19)22)24(26)27-21-9-3-17(15-25)4-10-21/h3-4,6-7,9-10,16,20H,2,5,8,11-14H2,1H3 |
| InChIKey | NQMWFOVHNKNYKT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|