C24H24F6O — CID 22045200
7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-fluoro-2-propyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 22045200) has the molecular formula C24H24F6O and a molecular weight of 442.44 g/mol. Its IUPAC name is 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-fluoro-2-propyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-fluoro-2-propyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045200 |
| Molecular Formula | C24H24F6O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6-fluoro-2-propyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | CCCC1CCC2c3cc(F)c(-c4cc(F)c(OC(F)(F)F)c(F)c4)cc3CCC2C1 |
| InChI | InChI=1S/C24H24F6O/c1-2-3-13-4-7-17-14(8-13)5-6-15-9-19(20(25)12-18(15)17)16-10-21(26)23(22(27)11-16)31-24(28,29)30/h9-14,17H,2-8H2,1H3 |
| InChIKey | QVNKEUAXXACJNU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |