C24H23F4N — CID 22045418
4-(1,3-difluoro-7-propyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile (PubChem CID 22045418) has the molecular formula C24H23F4N and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-(1,3-difluoro-7-propyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(1,3-difluoro-7-propyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 22045418 |
| Molecular Formula | C24H23F4N |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-(1,3-difluoro-7-propyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
| SMILES | CCCC1CCC2c3cc(F)c(-c4cc(F)c(C#N)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C24H23F4N/c1-2-3-13-4-6-16-14(8-13)5-7-17-18(16)11-22(27)23(24(17)28)15-9-20(25)19(12-29)21(26)10-15/h9-11,13-14,16H,2-8H2,1H3 |
| InChIKey | AMIAWXGOBNCIDT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |