C26H26F6O — CID 91461392
6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-pent-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 91461392) has the molecular formula C26H26F6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-pent-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-pent-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 91461392 |
| Molecular Formula | C26H26F6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-pent-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | CCCC=CC1CCC2c3cc(F)c(-c4ccc(OC(F)(F)F)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C26H26F6O/c1-2-3-4-5-15-6-9-18-16(12-15)7-10-19-20(18)14-22(28)24(25(19)29)17-8-11-23(21(27)13-17)33-26(30,31)32/h4-5,8,11,13-16,18H,2-3,6-7,9-10,12H2,1H3 |
| InChIKey | WWMPUVHRSFNURX-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|