C26H26F6 — CID 87877219
(2R,4aS,10aR)-6,8-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 87877219) has the molecular formula C26H26F6 and a molecular weight of 452.48 g/mol. Its IUPAC name is (2R,4aS,10aR)-6,8-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | (2R,4aS,10aR)-6,8-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 87877219 |
| Molecular Formula | C26H26F6 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (2R,4aS,10aR)-6,8-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]-2-[(E)-pent-3-enyl]-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | C/C=C/CC[C@@H]1CC[C@@H]2c3cc(F)c(-c4ccc(C(F)(F)F)c(F)c4)c(F)c3CC[C@@H]2C1 |
| InChI | InChI=1S/C26H26F6/c1-2-3-4-5-15-6-9-18-16(12-15)7-10-19-20(18)14-23(28)24(25(19)29)17-8-11-21(22(27)13-17)26(30,31)32/h2-3,8,11,13-16,18H,4-7,9-10,12H2,1H3/b3-2+/t15-,16-,18+/m1/s1 |
| InChIKey | ONECHICJNOIXST-KNQNTIDGSA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|