C24H21F7O — CID 91365040
7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6,8-difluoro-2-prop-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 91365040) has the molecular formula C24H21F7O and a molecular weight of 458.42 g/mol. Its IUPAC name is 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6,8-difluoro-2-prop-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6,8-difluoro-2-prop-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 91365040 |
| Molecular Formula | C24H21F7O |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-6,8-difluoro-2-prop-1-enyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | CC=CC1CCC2c3cc(F)c(-c4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C24H21F7O/c1-2-3-12-4-6-15-13(8-12)5-7-16-17(15)11-18(25)21(22(16)28)14-9-19(26)23(20(27)10-14)32-24(29,30)31/h2-3,9-13,15H,4-8H2,1H3 |
| InChIKey | YFJNVECWPYKYCA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|