C27H29F4N — CID 22044623
4-(1,3-difluoro-7-hexyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile (PubChem CID 22044623) has the molecular formula C27H29F4N and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-(1,3-difluoro-7-hexyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(1,3-difluoro-7-hexyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 22044623 |
| Molecular Formula | C27H29F4N |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-(1,3-difluoro-7-hexyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
| SMILES | CCCCCCC1CCC2c3cc(F)c(-c4cc(F)c(C#N)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C27H29F4N/c1-2-3-4-5-6-16-7-9-19-17(11-16)8-10-20-21(19)14-25(30)26(27(20)31)18-12-23(28)22(15-32)24(29)13-18/h12-14,16-17,19H,2-11H2,1H3 |
| InChIKey | PPRCWZGRIUTVMM-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|