C23H21F4N — CID 22045338
4-(7-ethyl-1,3-difluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile (PubChem CID 22045338) has the molecular formula C23H21F4N and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-(7-ethyl-1,3-difluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(7-ethyl-1,3-difluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 22045338 |
| Molecular Formula | C23H21F4N |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-(7-ethyl-1,3-difluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
| SMILES | CCC1CCC2c3cc(F)c(-c4cc(F)c(C#N)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C23H21F4N/c1-2-12-3-5-15-13(7-12)4-6-16-17(15)10-21(26)22(23(16)27)14-8-19(24)18(11-28)20(25)9-14/h8-10,12-13,15H,2-7H2,1H3 |
| InChIKey | NFIQXNXEPMUQNC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |