C25H26F3N — CID 22044689
4-(7-butyl-1-fluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile (PubChem CID 22044689) has the molecular formula C25H26F3N and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-(7-butyl-1-fluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(7-butyl-1-fluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 22044689 |
| Molecular Formula | C25H26F3N |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-(7-butyl-1-fluoro-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl)-2,6-difluorobenzonitrile |
| SMILES | CCCCC1CCC2c3ccc(-c4cc(F)c(C#N)c(F)c4)c(F)c3CCC2C1 |
| InChI | InChI=1S/C25H26F3N/c1-2-3-4-15-5-7-18-16(11-15)6-8-21-20(18)10-9-19(25(21)28)17-12-23(26)22(14-29)24(27)13-17/h9-10,12-13,15-16,18H,2-8,11H2,1H3 |
| InChIKey | WIBXMDARPZXNNS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |