C40H45N3O — CID 22048713
N-[3-[1-[5-(1,2-diphenylindol-3-yl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22048713) has the molecular formula C40H45N3O and a molecular weight of 583.82 g/mol. Its IUPAC name is N-[3-[1-[5-(1,2-diphenylindol-3-yl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-(1,2-diphenylindol-3-yl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22048713 |
| Molecular Formula | C40H45N3O |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | N-[3-[1-[5-(1,2-diphenylindol-3-yl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCCc3c(-c4ccccc4)n(-c4ccccc4)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C40H45N3O/c1-30(2)40(44)41-34-18-14-17-33(29-34)31-24-27-42(28-25-31)26-13-5-10-22-37-36-21-11-12-23-38(36)43(35-19-8-4-9-20-35)39(37)32-15-6-3-7-16-32/h3-4,6-9,11-12,14-21,23,29-31H,5,10,13,22,24-28H2,1-2H3,(H,41,44) |
| InChIKey | NWGQEIVHWWPQOO-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indole_3yl_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|