C32H39Cl2N3O4 — CID 22048795
6-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]hexyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 22048795) has the molecular formula C32H39Cl2N3O4 and a molecular weight of 600.59 g/mol. Its IUPAC name is 6-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]hexyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | 6-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]hexyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 22048795 |
| Molecular Formula | C32H39Cl2N3O4 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 6-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]hexyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)OCCCCCCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1 |
| InChI | InChI=1S/C32H39Cl2N3O4/c1-21(2)31(38)35-25-11-8-10-24(20-25)23-14-17-37(18-15-23)16-6-4-5-7-19-40-32(39)28-22(3)41-36-30(28)29-26(33)12-9-13-27(29)34/h8-13,20-21,23H,4-7,14-19H2,1-3H3,(H,35,38) |
| InChIKey | OGRAAPNQTLEEAL-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|