C19H15F2NO2 — CID 22051098
1-(2,6-difluorophenyl)-6-methyl-4-phenylmethoxypyridin-2-one (PubChem CID 22051098) has the molecular formula C19H15F2NO2 and a molecular weight of 327.33 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-6-methyl-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-(2,6-difluorophenyl)-6-methyl-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 22051098 |
| Molecular Formula | C19H15F2NO2 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-6-methyl-4-phenylmethoxypyridin-2-one |
| SMILES | Cc1cc(OCc2ccccc2)cc(=O)n1-c1c(F)cccc1F |
| InChI | InChI=1S/C19H15F2NO2/c1-13-10-15(24-12-14-6-3-2-4-7-14)11-18(23)22(13)19-16(20)8-5-9-17(19)21/h2-11H,12H2,1H3 |
| InChIKey | CHVHRDFVJAHEJB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |