C23H20N2O8 — CID 22054322
5-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-2-hydroxy-N-(4-nitrophenyl)benzamide (PubChem CID 22054322) has the molecular formula C23H20N2O8 and a molecular weight of 452.42 g/mol. Its IUPAC name is 5-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-2-hydroxy-N-(4-nitrophenyl)benzamide.
| Compound Name | 5-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-2-hydroxy-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 22054322 |
| Molecular Formula | C23H20N2O8 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-2-hydroxy-N-(4-nitrophenyl)benzamide |
| SMILES | COC1=C(OC)C(=O)C(Cc2ccc(O)c(C(=O)Nc3ccc([N+](=O)[O-])cc3)c2)=C(C)C1=O |
| InChI | InChI=1S/C23H20N2O8/c1-12-16(20(28)22(33-3)21(32-2)19(12)27)10-13-4-9-18(26)17(11-13)23(29)24-14-5-7-15(8-6-14)25(30)31/h4-9,11,26H,10H2,1-3H3,(H,24,29) |
| InChIKey | IZPBERYHMRZHLM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|