C37H31F15O5S2 — CID 22057173
[3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate (PubChem CID 22057173) has the molecular formula C37H31F15O5S2 and a molecular weight of 904.75 g/mol. Its IUPAC name is [3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate.
| Compound Name | [3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057173 |
| Molecular Formula | C37H31F15O5S2 |
| Molecular Weight | 904.75 g/mol |
| Exact Mass | 904.14 |
| IUPAC Name | [3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)Oc1cc(OC(C)(C)C)cc([S+](c2ccccc2)c2ccccc2)c1.O=S(=O)([O-])c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C26H31O2S.C11HF15O3S/c1-25(2,3)27-20-17-21(28-26(4,5)6)19-24(18-20)29(22-13-9-7-10-14-22)23-15-11-8-12-16-23;12-7(13,14)1-2(8(15,16)17)4(10(21,22)23)6(30(27,28)29)5(11(24,25)26)3(1)9(18,19)20/h7-19H,1-6H3;(H,27,28,29)/q+1;/p-1 |
| InChIKey | WDKVVQQIEBXRSV-UHFFFAOYSA-M |
| XLogP | 12.82 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.75 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|