C18H15Cl2FN4O2 — CID 22061053
2-chloro-4-[[2-(3-chloro-4-hydroxy-5-methylanilino)-5-fluoropyrimidin-4-yl]amino]-6-methylphenol (PubChem CID 22061053) has the molecular formula C18H15Cl2FN4O2 and a molecular weight of 409.25 g/mol. Its IUPAC name is 2-chloro-4-[[2-(3-chloro-4-hydroxy-5-methylanilino)-5-fluoropyrimidin-4-yl]amino]-6-methylphenol.
| Compound Name | 2-chloro-4-[[2-(3-chloro-4-hydroxy-5-methylanilino)-5-fluoropyrimidin-4-yl]amino]-6-methylphenol |
|---|---|
| PubChem CID | 22061053 |
| Molecular Formula | C18H15Cl2FN4O2 |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-chloro-4-[[2-(3-chloro-4-hydroxy-5-methylanilino)-5-fluoropyrimidin-4-yl]amino]-6-methylphenol |
| SMILES | Cc1cc(Nc2ncc(F)c(Nc3cc(C)c(O)c(Cl)c3)n2)cc(Cl)c1O |
| InChI | InChI=1S/C18H15Cl2FN4O2/c1-8-3-10(5-12(19)15(8)26)23-17-14(21)7-22-18(25-17)24-11-4-9(2)16(27)13(20)6-11/h3-7,26-27H,1-2H3,(H2,22,23,24,25) |
| InChIKey | IUSCIPMNZCDFAG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|