C10H15NO — CID 22064862
N-(4-ethylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 22064862) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(4-ethylcyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-(4-ethylcyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 22064862 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-(4-ethylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CCC1C=CC(NC(C)=O)=CC1 |
| InChI | InChI=1S/C10H15NO/c1-3-9-4-6-10(7-5-9)11-8(2)12/h4,6-7,9H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | AFYDMIXIQUHBSC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |