C24H46O4Si — CID 22074428
2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxydec-1-enyl]-1-hydroxycyclohexyl]acetic acid (PubChem CID 22074428) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxydec-1-enyl]-1-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxydec-1-enyl]-1-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22074428 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxydec-1-enyl]-1-hydroxycyclohexyl]acetic acid |
| SMILES | CCCCCCCC(/C=C/C1CCCC(O)(CC(=O)O)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O4Si/c1-7-8-9-10-11-14-21(28-29(5,6)23(2,3)4)16-15-20-13-12-17-24(27,18-20)19-22(25)26/h15-16,20-21,27H,7-14,17-19H2,1-6H3,(H,25,26)/b16-15+ |
| InChIKey | CHQRYNOIGQRLPT-FOCLMDBBSA-N |
| XLogP | 6.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|