About 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate
4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate (PubChem CID 22074510) has the molecular formula C13H20O5-2
and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 22074510 |
| Molecular Formula | C13H20O5-2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].CCC(CC)C(=O)CC(=O)[O-] |
| InChI | InChI=1S/C8H14O3.C5H8O2/c1-3-6(4-2)7(9)5-8(10)11;1-4(6)3-5(2)7/h6H,3-5H2,1-2H3,(H,10,11);3,6H,1-2H3/p-2/b;4-3- |
| InChIKey | PTOIZOGUZPOZIY-QGAMPUOQSA-L |
| XLogP | -0.03 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate?
The IUPAC name of 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate (CID 22074510) is 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].CCC(CC)C(=O)CC(=O)[O-].
What is the InChIKey of 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate?
The InChIKey is PTOIZOGUZPOZIY-QGAMPUOQSA-L. The full InChI is InChI=1S/C8H14O3.C5H8O2/c1-3-6(4-2)7(9)5-8(10)11;1-4(6)3-5(2)7/h6H,3-5H2,1-2H3,(H,10,11);3,6H,1-2H3/p-2/b;4-3-.
What are the key properties of 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate?
4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate has a molecular weight of 256.30 g/mol, XLogP of -0.03, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-oxohexanoate;(Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 22074510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).