C9H9N3O4 — CID 22079480
1,3-diazinane-2,4,6-trione;1H-pyridin-2-one (PubChem CID 22079480) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 1,3-diazinane-2,4,6-trione;1H-pyridin-2-one.
| Compound Name | 1,3-diazinane-2,4,6-trione;1H-pyridin-2-one |
|---|---|
| PubChem CID | 22079480 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1,3-diazinane-2,4,6-trione;1H-pyridin-2-one |
| SMILES | O=C1CC(=O)NC(=O)N1.O=c1cccc[nH]1 |
| InChI | InChI=1S/C5H5NO.C4H4N2O3/c7-5-3-1-2-4-6-5;7-2-1-3(8)6-4(9)5-2/h1-4H,(H,6,7);1H2,(H2,5,6,7,8,9) |
| InChIKey | PMVUZXSGFLBPQZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|