C9H8N2O2 — CID 23558224
3-methylidene-1,9a-dihydropyrido[1,2-a]pyrimidine-2,4-dione (PubChem CID 23558224) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-methylidene-1,9a-dihydropyrido[1,2-a]pyrimidine-2,4-dione.
| Compound Name | 3-methylidene-1,9a-dihydropyrido[1,2-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23558224 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-methylidene-1,9a-dihydropyrido[1,2-a]pyrimidine-2,4-dione |
| SMILES | C=C1C(=O)NC2C=CC=CN2C1=O |
| InChI | InChI=1S/C9H8N2O2/c1-6-8(12)10-7-4-2-3-5-11(7)9(6)13/h2-5,7H,1H2,(H,10,12) |
| InChIKey | YDZAHJORXSKPRO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|