C9H10N2O — CID 91244179
3-methylidene-2,6-dihydro-1H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 91244179) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-methylidene-2,6-dihydro-1H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-methylidene-2,6-dihydro-1H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 91244179 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-methylidene-2,6-dihydro-1H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C1CNC2=CC=CCN2C1=O |
| InChI | InChI=1S/C9H10N2O/c1-7-6-10-8-4-2-3-5-11(8)9(7)12/h2-4,10H,1,5-6H2 |
| InChIKey | QSBUQYSEVXLOLN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|