C8H14O — CID 22082046
2-ethyl-3-methyl-3,4-dihydro-2H-pyran (PubChem CID 22082046) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethyl-3-methyl-3,4-dihydro-2H-pyran.
| Compound Name | 2-ethyl-3-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 22082046 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 2-ethyl-3-methyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1OC=CCC1C |
| InChI | InChI=1S/C8H14O/c1-3-8-7(2)5-4-6-9-8/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | SNESHDOFFYMQSR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |