C29H23BrN2O3S — CID 22083990
3-[(1-bromonaphthalen-2-yl)methyl]-2-methyl-N-[(E)-2-phenylethenyl]sulfonyl-1H-indole-5-carboxamide (PubChem CID 22083990) has the molecular formula C29H23BrN2O3S and a molecular weight of 559.49 g/mol. Its IUPAC name is 3-[(1-bromonaphthalen-2-yl)methyl]-2-methyl-N-[(E)-2-phenylethenyl]sulfonyl-1H-indole-5-carboxamide.
| Compound Name | 3-[(1-bromonaphthalen-2-yl)methyl]-2-methyl-N-[(E)-2-phenylethenyl]sulfonyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 22083990 |
| Molecular Formula | C29H23BrN2O3S |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 3-[(1-bromonaphthalen-2-yl)methyl]-2-methyl-N-[(E)-2-phenylethenyl]sulfonyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NS(=O)(=O)/C=C/c3ccccc3)cc2c1Cc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C29H23BrN2O3S/c1-19-25(17-22-12-11-21-9-5-6-10-24(21)28(22)30)26-18-23(13-14-27(26)31-19)29(33)32-36(34,35)16-15-20-7-3-2-4-8-20/h2-16,18,31H,17H2,1H3,(H,32,33)/b16-15+ |
| InChIKey | ZQXDXCYCHDWBNP-FOCLMDBBSA-N |
| XLogP | 6.71 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|