C17H16BrNO5S — CID 75403969
4-bromo-3,5-dimethoxy-N-[(E)-2-phenylethenyl]sulfonylbenzamide (PubChem CID 75403969) has the molecular formula C17H16BrNO5S and a molecular weight of 426.29 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[(E)-2-phenylethenyl]sulfonylbenzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[(E)-2-phenylethenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 75403969 |
| Molecular Formula | C17H16BrNO5S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[(E)-2-phenylethenyl]sulfonylbenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)/C=C/c2ccccc2)cc(OC)c1Br |
| InChI | InChI=1S/C17H16BrNO5S/c1-23-14-10-13(11-15(24-2)16(14)18)17(20)19-25(21,22)9-8-12-6-4-3-5-7-12/h3-11H,1-2H3,(H,19,20)/b9-8+ |
| InChIKey | DJJQYRAOFMUSJB-CMDGGOBGSA-N |
| XLogP | 3.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |