C33H52O — CID 22085426
1-[[4-(4-methylpent-3-enyl)cyclohexyl]methoxy]-4-[2-[4-(4-methylpentyl)cyclohex-3-en-1-yl]ethyl]benzene (PubChem CID 22085426) has the molecular formula C33H52O and a molecular weight of 464.78 g/mol. Its IUPAC name is 1-[[4-(4-methylpent-3-enyl)cyclohexyl]methoxy]-4-[2-[4-(4-methylpentyl)cyclohex-3-en-1-yl]ethyl]benzene.
| Compound Name | 1-[[4-(4-methylpent-3-enyl)cyclohexyl]methoxy]-4-[2-[4-(4-methylpentyl)cyclohex-3-en-1-yl]ethyl]benzene |
|---|---|
| PubChem CID | 22085426 |
| Molecular Formula | C33H52O |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.40 |
| IUPAC Name | 1-[[4-(4-methylpent-3-enyl)cyclohexyl]methoxy]-4-[2-[4-(4-methylpentyl)cyclohex-3-en-1-yl]ethyl]benzene |
| SMILES | CC(C)=CCCC1CCC(COc2ccc(CCC3CC=C(CCCC(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C33H52O/c1-26(2)7-5-9-28-11-13-30(14-12-28)15-16-31-21-23-33(24-22-31)34-25-32-19-17-29(18-20-32)10-6-8-27(3)4/h8,11,21-24,26,29-30,32H,5-7,9-10,12-20,25H2,1-4H3 |
| InChIKey | PAWLYKISUOYFOJ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|