C22H25N3O4S — CID 22086028
(4-cyano-2,2-dioxo-3,4-dihydro-1H-isothiochromen-3-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22086028) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is (4-cyano-2,2-dioxo-3,4-dihydro-1H-isothiochromen-3-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | (4-cyano-2,2-dioxo-3,4-dihydro-1H-isothiochromen-3-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22086028 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (4-cyano-2,2-dioxo-3,4-dihydro-1H-isothiochromen-3-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC2C(C#N)c3ccccc3CS2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-25(5-2)17-10-11-20(15(3)12-17)24-22(26)29-21-19(13-23)18-9-7-6-8-16(18)14-30(21,27)28/h6-12,19,21H,4-5,14H2,1-3H3,(H,24,26) |
| InChIKey | ASTIETLMKSHVGK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|