C23H33NO9 — CID 22086266
diethyl 2-[[4-[3-(3,4,5-trihydroxy-6-methyloxan-2-yl)propyl]benzoyl]amino]propanedioate (PubChem CID 22086266) has the molecular formula C23H33NO9 and a molecular weight of 467.52 g/mol. Its IUPAC name is diethyl 2-[[4-[3-(3,4,5-trihydroxy-6-methyloxan-2-yl)propyl]benzoyl]amino]propanedioate.
| Compound Name | diethyl 2-[[4-[3-(3,4,5-trihydroxy-6-methyloxan-2-yl)propyl]benzoyl]amino]propanedioate |
|---|---|
| PubChem CID | 22086266 |
| Molecular Formula | C23H33NO9 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | diethyl 2-[[4-[3-(3,4,5-trihydroxy-6-methyloxan-2-yl)propyl]benzoyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(CCCC2OC(C)C(O)C(O)C2O)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H33NO9/c1-4-31-22(29)17(23(30)32-5-2)24-21(28)15-11-9-14(10-12-15)7-6-8-16-19(26)20(27)18(25)13(3)33-16/h9-13,16-20,25-27H,4-8H2,1-3H3,(H,24,28) |
| InChIKey | PQZYJGXXWUKCIR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|