C22H25BrN6O8 — CID 22088425
[3-acetyloxy-5-[4-[2-(2-azidoethoxymethyl)-6-hydroxyanilino]-5-bromo-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 22088425) has the molecular formula C22H25BrN6O8 and a molecular weight of 581.38 g/mol. Its IUPAC name is [3-acetyloxy-5-[4-[2-(2-azidoethoxymethyl)-6-hydroxyanilino]-5-bromo-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-5-[4-[2-(2-azidoethoxymethyl)-6-hydroxyanilino]-5-bromo-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22088425 |
| Molecular Formula | C22H25BrN6O8 |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | [3-acetyloxy-5-[4-[2-(2-azidoethoxymethyl)-6-hydroxyanilino]-5-bromo-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cc(Br)c(Nc3c(O)cccc3COCCN=[N+]=[N-])nc2=O)CC1OC(C)=O |
| InChI | InChI=1S/C22H25BrN6O8/c1-12(30)35-11-18-17(36-13(2)31)8-19(37-18)29-9-15(23)21(27-22(29)33)26-20-14(4-3-5-16(20)32)10-34-7-6-25-28-24/h3-5,9,17-19,32H,6-8,10-11H2,1-2H3,(H,26,27,33) |
| InChIKey | KRNPUXSLQHFBCM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 186.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|