C33H39Cl2NO4 — CID 22088832
methyl 3-[4-[2-[2,2-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-8-oxononanoate (PubChem CID 22088832) has the molecular formula C33H39Cl2NO4 and a molecular weight of 584.58 g/mol. Its IUPAC name is methyl 3-[4-[2-[2,2-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-8-oxononanoate.
| Compound Name | methyl 3-[4-[2-[2,2-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-8-oxononanoate |
|---|---|
| PubChem CID | 22088832 |
| Molecular Formula | C33H39Cl2NO4 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | methyl 3-[4-[2-[2,2-bis(4-chlorophenyl)ethyl-methylamino]ethoxy]phenyl]-8-oxononanoate |
| SMILES | COC(=O)CC(CCCCC(C)=O)c1ccc(OCCN(C)CC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H39Cl2NO4/c1-24(37)6-4-5-7-28(22-33(38)39-3)25-12-18-31(19-13-25)40-21-20-36(2)23-32(26-8-14-29(34)15-9-26)27-10-16-30(35)17-11-27/h8-19,28,32H,4-7,20-23H2,1-3H3 |
| InChIKey | HBBFGKFPDMLZTA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|